Molecular Definition

Canonical SMILES Nc1ncc(cn1)c2nc(N3CCOCC3)c4ncccc4n2
Formula C15H15N7O
Molecular Weight 309.33 da
Stereocenters 0/0