Molecular Definition

Canonical SMILES N[C@@H]1C[C@H]1c2ccc(NC(=O)c3ccnc(c3)c4cc(ccn4)C(=O)O)cc2.OC(=O)C(F)(F)F
Formula C23H19F3N4O5
Molecular Weight 488.42 da
Stereocenters 2/2