Target Relevance

Molecular Definition

Canonical SMILES CCCCN1CCN(C1=O)c2nc(C)c(s2)C(=O)NCc3cccnc3
Formula C18H23N5O2S
Molecular Weight 373.47 da
Stereocenters 0/0