Molecular Definition

Canonical SMILES Cc1cc(cc(C)c1OC(C)(C)C(=O)O)C2CC2C(OC(=O)c3ccccc3)c4ccc(OC(F)(F)F)cc4
Formula C30H29F3O6
Molecular Weight 542.54 da
Stereocenters 0/3