Molecular Definition

Canonical SMILES CN(CCN)c1ccc(Nc2cc(NC3CC3)n4ncc(C#N)c4n2)cc1NC(=O)C
Formula C21H25N9O
Molecular Weight 419.48 da
Stereocenters 0/0