Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(CCNC[C@H](O)c2cc(O)cc(O)c2)cc1
Formula C17H21NO4
Molecular Weight 303.35 da
Stereocenters 1/1