Molecular Definition

Canonical SMILES N[C@@H](Cc1ccc(cc1)C#N)C(=O)N2CCC[C@H]2C#N
Formula C15H16N4O
Molecular Weight 268.31 da
Stereocenters 2/2