Molecular Definition

Canonical SMILES N[C@@H](Cc1cc(F)cc(F)c1F)C(=O)N2C[C@@H](F)C[C@H]2C#N
Formula C14H13F4N3O
Molecular Weight 315.27 da
Stereocenters 3/3