Molecular Definition

Canonical SMILES N[C@@H](Cc1ccc(cc1)C#N)C(=O)N2C[C@@H](F)C[C@H]2C#N
Formula C15H15FN4O
Molecular Weight 286.30 da
Stereocenters 3/3