Molecular Definition

Canonical SMILES CCCCC(=O)OC[C@H]1O[C@H]([C@H](OC(=O)CCCC)[C@@H](OC(=O)CCCC)[C@@H]1OC(=O)CCCC)n2cc(nn2)c3ccc(cc3)S(=O)(=O)N
Formula C34H50N4O11S
Molecular Weight 722.85 da
Stereocenters 5/5