Molecular Definition

Canonical SMILES CC(=O)OC[C@H]1O[C@H]([C@H](OC(=O)C)[C@@H](OC(=O)C)[C@H]1OC(=O)C)n2cc(nn2)c3cccc(c3)S(=O)(=O)N
Formula C22H26N4O11S
Molecular Weight 554.53 da
Stereocenters 5/5