Molecular Definition

Canonical SMILES CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)N[C@H]2CCc3nc(N)sc3C2
Formula C17H26N4O3S
Molecular Weight 366.48 da
Stereocenters 2/2