Molecular Definition

Canonical SMILES OC(=O)c1cccc(O)c1C(=O)c2c(O)cc(cc2O)C(=O)OC3C4CCN(CC4)CC3NC(=O)c5ccc(O)cc5
Formula C30H28N2O10
Molecular Weight 576.55 da
Stereocenters 0/2