Target Relevance

Molecular Definition

Canonical SMILES Brc1ccc(cc1)S(=O)(=O)N2C(=O)CN(C2=O)c3ccccc3
Formula C15H11BrN2O4S
Molecular Weight 395.23 da
Stereocenters 0/0