Target Relevance

Molecular Definition

Canonical SMILES O[C@@H](CNCCc1ccc(NS(=O)(=O)c2ccc(I)cc2)cc1)COc3ccc(F)cc3
Formula C23H24FIN2O4S
Molecular Weight 570.42 da
Stereocenters 1/1