Molecular Definition

Canonical SMILES Oc1ccc(cc1)[C@H]2Sc3cc(O)ccc3O[C@H]2c4ccc(OCCN5CCCCC5)cc4
Formula C27H29NO4S
Molecular Weight 463.59 da
Stereocenters 2/2