Molecular Definition

Canonical SMILES CCCCN(Cc1ccccc1)Cc2nc(CCC)n(Cc3ccc(cc3)c4ccccc4c5nn[nH]n5)c2C(=O)O
Formula C33H37N7O2
Molecular Weight 563.69 da
Stereocenters 0/0