Molecular Definition

Canonical SMILES [O-][N+](=O)c1ccccc1S(=O)(=O)NC[C@@H]2CC[C@@H](CNCC3CCc4ccccc4C3)CC2
Formula C25H33N3O4S
Molecular Weight 471.61 da
Stereocenters 2/3