Molecular Definition

Canonical SMILES COc1cc2c(CCNC(=O)C)c[nH]c2cc1[N+](=O)[O-]
Formula C13H15N3O4
Molecular Weight 277.28 da
Stereocenters 0/0