Molecular Definition

Canonical SMILES C(\C=C\c1ccccc1)[C@H]2C3CCC(C3)[C@H]2NC4=NCCO4
Formula C19H24N2O
Molecular Weight 296.41 da
Stereocenters 2/4