Target Relevance

Molecular Definition

Canonical SMILES CCOc1ccccc1C(=O)N[C@@]2(OC)[C@H]3OCC(=C(N3C2=O)C(=O)OCc4ccc(cc4)C(=O)O)CSc5nnnn5C
Formula C28H28N6O9S
Molecular Weight 624.62 da
Stereocenters 2/2