Molecular Definition

Canonical SMILES COc1ccc(cc1)S(=O)(=O)C2CCCC(S)C2
Formula C13H18O3S2
Molecular Weight 286.41 da
Stereocenters 0/2