Target Relevance

Molecular Definition

Canonical SMILES Cc1cc(Cn2cnc3CN([C@@H](Cc23)C(=O)O)C(=O)C(c4ccccc4)c5ccccc5)ccc1N
Formula C29H28N4O3
Molecular Weight 480.56 da
Stereocenters 1/1