Molecular Definition

Canonical SMILES CC(C)(C)c1snc(O)c1C[C@H](N)C(=O)O
Formula C10H16N2O3S
Molecular Weight 244.31 da
Stereocenters 1/1