Molecular Definition

Canonical SMILES CC#CCOc1ccc(cc1)S(=O)(=O)N(C)c2c(cnc3c2c(C)nn3C)C(=O)NO
Formula C20H21N5O5S
Molecular Weight 443.48 da
Stereocenters 0/0