Molecular Definition

Canonical SMILES CN(c1c(cnc2ccccc12)C(=O)NO)S(=O)(=O)c3ccc(Oc4ccncc4)cc3
Formula C22H18N4O5S
Molecular Weight 450.47 da
Stereocenters 0/0