Target Relevance

Molecular Definition

Canonical SMILES Fc1cccc2N(C3CCN(CC3)C(=O)c4ccc5oc(CNC(=O)CN6C=C(C=CC6=O)C(F)(F)F)cc5c4)C(=O)OCc12
Formula C31H26F4N4O6
Molecular Weight 626.56 da
Stereocenters 0/0