Molecular Definition

Canonical SMILES O=C1CC2(CCCC2)CC(=O)N1CCCCN3C4CCC3c5c(C4)[nH]c6ccccc56
Formula C26H33N3O2
Molecular Weight 419.56 da
Stereocenters 0/2