Molecular Definition

Canonical SMILES N[C@@H](CC1=CCCCc2onc(O)c12)C(=O)O
Formula C11H14N2O4
Molecular Weight 238.24 da
Stereocenters 1/1