Molecular Definition

Canonical SMILES C1CC(c2c[nH]cn2)c3ccsc3C1
Formula C11H12N2S
Molecular Weight 204.29 da
Stereocenters 0/1