Target Relevance

Molecular Definition

Canonical SMILES COC(=O)c1ccc2oc(nc2c1)C(=O)C(Cc3ccccc3)NC(=O)CN4C(=O)C(=CN=C4c5ccc(F)cc5)N
Formula C30H24FN5O6
Molecular Weight 569.54 da
Stereocenters 0/1