Target Relevance

Molecular Definition

Canonical SMILES Clc1ccc(cc1)n2nc(nc2c3ccc(Cl)cc3Cl)C(=O)NC4CCc5ccccc45
Formula C24H17Cl3N4O
Molecular Weight 483.78 da
Stereocenters 0/1