Molecular Definition

Canonical SMILES Cc1onc(O)c1C[C@H](N)C(=O)O
Formula C7H10N2O4
Molecular Weight 186.17 da
Stereocenters 1/1