Molecular Definition

Canonical SMILES OC(=O)C1=CC(=C(c2ccc(O)c(c2)C(=O)O)c3ccc(O)c(c3)C(=O)O)C=CC1=O
Formula C22H14O9
Molecular Weight 422.34 da
Stereocenters 0/0