Molecular Definition

Canonical SMILES Cc1[nH]c(\C=C\2/C(=O)Nc3ccccc23)c(C)c1CCC(=O)O
Formula C18H18N2O3
Molecular Weight 310.35 da
Stereocenters 0/0