Molecular Definition

Canonical SMILES COc1ccc(Cl)cc1NC(=O)NC2CCC(CC2)N3CCN(CC3)c4ccccc4OC(C)C
Formula C27H37ClN4O3
Molecular Weight 501.06 da
Stereocenters 0/0