Molecular Definition

Canonical SMILES NS(=O)(=O)c1ccc(N\C=C\2/C(=O)Nc3ccc4ncsc4c23)cc1
Formula C16H12N4O3S2
Molecular Weight 372.42 da
Stereocenters 0/0