Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(c(c1)[N+](=O)[O-])S(=O)(=O)Nc2cccc3ccc(C)nc23
Formula C17H15N3O5S
Molecular Weight 373.38 da
Stereocenters 0/0