Molecular Definition

Canonical SMILES COc1ccc(\C=C\2/SC(=S)NC2=O)cc1OC3CCCC3
Formula C16H17NO3S2
Molecular Weight 335.44 da
Stereocenters 0/0