Molecular Definition

Canonical SMILES CC(C)Oc1ccccc1N2CCN(CC2)C3CCC(CC3)NC(=O)Nc4c(F)cccc4F
Formula C26H34F2N4O2
Molecular Weight 472.57 da
Stereocenters 0/0