Molecular Definition

Canonical SMILES COc1ccc(c2ccc(NC(=O)Nc3cc(C)ccc3F)cc2)c4c(N)noc14
Formula C22H19FN4O3
Molecular Weight 406.41 da
Stereocenters 0/0