Target Relevance

Molecular Definition

Canonical SMILES CC1(C)OC(=Nc2ccc(cc12)c3cc(Br)cc(OC(F)(F)F)c3)S
Formula C17H13BrF3NO2S
Molecular Weight 432.26 da
Stereocenters 0/0