Target Relevance

Molecular Definition

Canonical SMILES COc1cc(Oc2c(I)cc(CC3NC(=O)NC3=O)cc2I)ccc1O
Formula C17H14I2N2O5
Molecular Weight 580.11 da
Stereocenters 0/1