Target Relevance

Molecular Definition

Canonical SMILES COC(=O)c1ccc2oc(nc2c1)C(=O)C(Cc3ccccc3)NC(=O)CN4C(=O)C(=CN=C4c5cccc(OC)c5)N
Formula C31H27N5O7
Molecular Weight 581.58 da
Stereocenters 0/1