Target Relevance

Molecular Definition

Canonical SMILES c1ccc(nc1)c2n[nH]cc2c3ccnc4ccccc34
Formula C17H12N4
Molecular Weight 272.30 da
Stereocenters 0/0