Molecular Definition

Canonical SMILES [O-][N+](=O)C1(Br)COC(OC1)c2ccccc2
Formula C10H10BrNO4
Molecular Weight 288.10 da
Stereocenters 0/0