Target Relevance

Molecular Definition

Canonical SMILES Fc1ccc(cc1)c2[nH]c3ccc(cc3c2CCCC(=O)NS(=O)(=O)C(F)(F)F)C#N
Formula C20H15F4N3O3S
Molecular Weight 453.41 da
Stereocenters 0/0