Target Relevance

Molecular Definition

Canonical SMILES OC(=O)[C@H](Cc1ccc(cc1)c2ccccc2)NC(=O)[C@@H](S)C3CCCCC3
Formula C23H27NO3S
Molecular Weight 397.53 da
Stereocenters 2/2