Target Relevance

Molecular Definition

Canonical SMILES Nc1ccc(cc1NC(=O)c2cccnc2)n3ccnc3
Formula C15H13N5O
Molecular Weight 279.30 da
Stereocenters 0/0