Target Relevance

Molecular Definition

Canonical SMILES CC(=O)CC(=O)NCCCN1CCC(CC1)(c2ccccc2)c3ccccc3
Formula C24H30N2O2
Molecular Weight 378.51 da
Stereocenters 0/0